C23H19F4N3O3S — CID 55765362
N-[4-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)anilino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 55765362) has the molecular formula C23H19F4N3O3S and a molecular weight of 493.48 g/mol. Its IUPAC name is N-[4-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)anilino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)anilino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55765362 |
| Molecular Formula | C23H19F4N3O3S |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | N-[4-[4-[(2-fluorobenzoyl)amino]-2-(trifluoromethyl)anilino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1cccs1)Nc1ccc(NC(=O)c2ccccc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C23H19F4N3O3S/c24-17-6-2-1-5-15(17)21(32)29-14-9-10-18(16(13-14)23(25,26)27)30-20(31)8-3-11-28-22(33)19-7-4-12-34-19/h1-2,4-7,9-10,12-13H,3,8,11H2,(H,28,33)(H,29,32)(H,30,31) |
| InChIKey | ZPRHOWXAYZGZOP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|