C18H20F3N3O2S — CID 55642461
N-[4-[4-(dimethylamino)-2-(trifluoromethyl)anilino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 55642461) has the molecular formula C18H20F3N3O2S and a molecular weight of 399.44 g/mol. Its IUPAC name is N-[4-[4-(dimethylamino)-2-(trifluoromethyl)anilino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[4-(dimethylamino)-2-(trifluoromethyl)anilino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55642461 |
| Molecular Formula | C18H20F3N3O2S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[4-[4-(dimethylamino)-2-(trifluoromethyl)anilino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)CCCNC(=O)c2cccs2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3N3O2S/c1-24(2)12-7-8-14(13(11-12)18(19,20)21)23-16(25)6-3-9-22-17(26)15-5-4-10-27-15/h4-5,7-8,10-11H,3,6,9H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | NTRDWHYJXHYNPJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|