C22H16F4N2O3 — CID 55765497
2-fluoro-N-[4-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 55765497) has the molecular formula C22H16F4N2O3 and a molecular weight of 432.37 g/mol. Its IUPAC name is 2-fluoro-N-[4-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55765497 |
| Molecular Formula | C22H16F4N2O3 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-fluoro-N-[4-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2ccc(NC(=O)c3ccccc3F)cc2C(F)(F)F)o1 |
| InChI | InChI=1S/C22H16F4N2O3/c1-13-6-8-15(31-13)9-11-20(29)28-19-10-7-14(12-17(19)22(24,25)26)27-21(30)16-4-2-3-5-18(16)23/h2-12H,1H3,(H,27,30)(H,28,29)/b11-9+ |
| InChIKey | VMRLJRBMUVAAFI-PKNBQFBNSA-N |
| XLogP | 5.65 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|