C29H28F3N3O3 — CID 159824652
(E)-N-[2-methyl-5-[2-[4-(morpholin-4-ylmethyl)-3-(trifluoromethyl)phenyl]acetyl]phenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 159824652) has the molecular formula C29H28F3N3O3 and a molecular weight of 523.56 g/mol. Its IUPAC name is (E)-N-[2-methyl-5-[2-[4-(morpholin-4-ylmethyl)-3-(trifluoromethyl)phenyl]acetyl]phenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-methyl-5-[2-[4-(morpholin-4-ylmethyl)-3-(trifluoromethyl)phenyl]acetyl]phenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 159824652 |
| Molecular Formula | C29H28F3N3O3 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | (E)-N-[2-methyl-5-[2-[4-(morpholin-4-ylmethyl)-3-(trifluoromethyl)phenyl]acetyl]phenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1ccc(C(=O)Cc2ccc(CN3CCOCC3)c(C(F)(F)F)c2)cc1NC(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C29H28F3N3O3/c1-20-4-7-23(17-26(20)34-28(37)9-6-21-3-2-10-33-18-21)27(36)16-22-5-8-24(25(15-22)29(30,31)32)19-35-11-13-38-14-12-35/h2-10,15,17-18H,11-14,16,19H2,1H3,(H,34,37)/b9-6+ |
| InChIKey | NMRHLKGOUKYITR-RMKNXTFCSA-N |
| XLogP | 5.32 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|