C30H31F3N4O2 — CID 158748680
(E)-N-[5-[2-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]acetyl]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 158748680) has the molecular formula C30H31F3N4O2 and a molecular weight of 536.60 g/mol. Its IUPAC name is (E)-N-[5-[2-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]acetyl]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[2-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]acetyl]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 158748680 |
| Molecular Formula | C30H31F3N4O2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | (E)-N-[5-[2-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]acetyl]-2-methylphenyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CCN1CCN(c2ccc(CC(=O)c3ccc(C)c(NC(=O)/C=C/c4cccnc4)c3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C30H31F3N4O2/c1-3-36-13-15-37(16-14-36)27-10-7-23(17-25(27)30(31,32)33)18-28(38)24-9-6-21(2)26(19-24)35-29(39)11-8-22-5-4-12-34-20-22/h4-12,17,19-20H,3,13-16,18H2,1-2H3,(H,35,39)/b11-8+ |
| InChIKey | INEQTOGDAMWZBY-DHZHZOJOSA-N |
| XLogP | 5.63 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|