C32H34F3N5O2S — CID 144863547
N-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-methyl-3-(methylamino)benzamide;5-thiophen-2-ylpyridine-3-carbaldehyde (PubChem CID 144863547) has the molecular formula C32H34F3N5O2S and a molecular weight of 609.72 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-methyl-3-(methylamino)benzamide;5-thiophen-2-ylpyridine-3-carbaldehyde.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-methyl-3-(methylamino)benzamide;5-thiophen-2-ylpyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 144863547 |
| Molecular Formula | C32H34F3N5O2S |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]-4-methyl-3-(methylamino)benzamide;5-thiophen-2-ylpyridine-3-carbaldehyde |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc(C)c(NC)c3)cc2C(F)(F)F)CC1.O=Cc1cncc(-c2cccs2)c1 |
| InChI | InChI=1S/C22H27F3N4O.C10H7NOS/c1-4-28-9-11-29(12-10-28)20-8-7-17(14-18(20)22(23,24)25)27-21(30)16-6-5-15(2)19(13-16)26-3;12-7-8-4-9(6-11-5-8)10-2-1-3-13-10/h5-8,13-14,26H,4,9-12H2,1-3H3,(H,27,30);1-7H |
| InChIKey | DMTQRFIFPVPEDF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|