C27H27F3N4O3 — CID 174642582
4-methyl-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]benzamide;3-pyridin-3-ylprop-2-enamide (PubChem CID 174642582) has the molecular formula C27H27F3N4O3 and a molecular weight of 512.53 g/mol. Its IUPAC name is 4-methyl-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]benzamide;3-pyridin-3-ylprop-2-enamide.
| Compound Name | 4-methyl-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]benzamide;3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 174642582 |
| Molecular Formula | C27H27F3N4O3 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 4-methyl-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]benzamide;3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCOCC3)c(C(F)(F)F)c2)cc1.NC(=O)C=Cc1cccnc1 |
| InChI | InChI=1S/C19H19F3N2O2.C8H8N2O/c1-13-2-4-14(5-3-13)18(25)23-15-6-7-17(16(12-15)19(20,21)22)24-8-10-26-11-9-24;9-8(11)4-3-7-2-1-5-10-6-7/h2-7,12H,8-11H2,1H3,(H,23,25);1-6H,(H2,9,11) |
| InChIKey | DQZQEPJNQRQKOQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|