C23H20F3N3O2 — CID 174709439
4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide;3-pyridin-3-ylprop-2-enamide (PubChem CID 174709439) has the molecular formula C23H20F3N3O2 and a molecular weight of 427.43 g/mol. Its IUPAC name is 4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide;3-pyridin-3-ylprop-2-enamide.
| Compound Name | 4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide;3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 174709439 |
| Molecular Formula | C23H20F3N3O2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide;3-pyridin-3-ylprop-2-enamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1.NC(=O)C=Cc1cccnc1 |
| InChI | InChI=1S/C15H12F3NO.C8H8N2O/c1-10-5-7-11(8-6-10)14(20)19-13-4-2-3-12(9-13)15(16,17)18;9-8(11)4-3-7-2-1-5-10-6-7/h2-9H,1H3,(H,19,20);1-6H,(H2,9,11) |
| InChIKey | SRJQVNLSUKKMCP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|