C14H10F2N2O — CID 47148193
(E)-N-(2,4-difluorophenyl)-3-pyridin-3-ylprop-2-enamide (PubChem CID 47148193) has the molecular formula C14H10F2N2O and a molecular weight of 260.24 g/mol. Its IUPAC name is (E)-N-(2,4-difluorophenyl)-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-(2,4-difluorophenyl)-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 47148193 |
| Molecular Formula | C14H10F2N2O |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (E)-N-(2,4-difluorophenyl)-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C14H10F2N2O/c15-11-4-5-13(12(16)8-11)18-14(19)6-3-10-2-1-7-17-9-10/h1-9H,(H,18,19)/b6-3+ |
| InChIKey | FRULMFGDSHCKBG-ZZXKWVIFSA-N |
| XLogP | 3.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|