C30H22N6O6 — CID 4192705
3-(3-nitrophenyl)-N-[3-[3-(3-nitrophenyl)prop-2-enoylamino]-4-phenyldiazenylphenyl]prop-2-enamide (PubChem CID 4192705) has the molecular formula C30H22N6O6 and a molecular weight of 562.54 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-N-[3-[3-(3-nitrophenyl)prop-2-enoylamino]-4-phenyldiazenylphenyl]prop-2-enamide.
| Compound Name | 3-(3-nitrophenyl)-N-[3-[3-(3-nitrophenyl)prop-2-enoylamino]-4-phenyldiazenylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4192705 |
| Molecular Formula | C30H22N6O6 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | 3-(3-nitrophenyl)-N-[3-[3-(3-nitrophenyl)prop-2-enoylamino]-4-phenyldiazenylphenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)Nc1ccc(/N=N/c2ccccc2)c(NC(=O)C=Cc2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C30H22N6O6/c37-29(16-12-21-6-4-10-25(18-21)35(39)40)31-24-14-15-27(34-33-23-8-2-1-3-9-23)28(20-24)32-30(38)17-13-22-7-5-11-26(19-22)36(41)42/h1-20H,(H,31,37)(H,32,38)/b16-12?,17-13?,34-33+ |
| InChIKey | KLWUECTWPJWJGK-SGWFMVAVSA-N |
| XLogP | 7.22 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|