C26H18Br2N4O2 — CID 4259733
4-bromo-N-[3-[(4-bromobenzoyl)amino]-4-phenyldiazenylphenyl]benzamide (PubChem CID 4259733) has the molecular formula C26H18Br2N4O2 and a molecular weight of 578.26 g/mol. Its IUPAC name is 4-bromo-N-[3-[(4-bromobenzoyl)amino]-4-phenyldiazenylphenyl]benzamide.
| Compound Name | 4-bromo-N-[3-[(4-bromobenzoyl)amino]-4-phenyldiazenylphenyl]benzamide |
|---|---|
| PubChem CID | 4259733 |
| Molecular Formula | C26H18Br2N4O2 |
| Molecular Weight | 578.26 g/mol |
| Exact Mass | 575.98 |
| IUPAC Name | 4-bromo-N-[3-[(4-bromobenzoyl)amino]-4-phenyldiazenylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)c(NC(=O)c2ccc(Br)cc2)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H18Br2N4O2/c27-19-10-6-17(7-11-19)25(33)29-22-14-15-23(32-31-21-4-2-1-3-5-21)24(16-22)30-26(34)18-8-12-20(28)13-9-18/h1-16H,(H,29,33)(H,30,34)/b32-31+ |
| InChIKey | OHUCPDRWTGSQCW-QNEJGDQOSA-N |
| XLogP | 8.13 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.26 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|