C31H18N4O8 — CID 102320112
N-[3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-4-[(4-methylphenyl)diazenyl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide (PubChem CID 102320112) has the molecular formula C31H18N4O8 and a molecular weight of 574.51 g/mol. Its IUPAC name is N-[3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-4-[(4-methylphenyl)diazenyl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide.
| Compound Name | N-[3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-4-[(4-methylphenyl)diazenyl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 102320112 |
| Molecular Formula | C31H18N4O8 |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | N-[3-[(1,3-dioxo-2-benzofuran-5-carbonyl)amino]-4-[(4-methylphenyl)diazenyl]phenyl]-1,3-dioxo-2-benzofuran-5-carboxamide |
| SMILES | Cc1ccc(/N=N/c2ccc(NC(=O)c3ccc4c(c3)C(=O)OC4=O)cc2NC(=O)c2ccc3c(c2)C(=O)OC3=O)cc1 |
| InChI | InChI=1S/C31H18N4O8/c1-15-2-6-18(7-3-15)34-35-24-11-8-19(32-26(36)16-4-9-20-22(12-16)30(40)42-28(20)38)14-25(24)33-27(37)17-5-10-21-23(13-17)31(41)43-29(21)39/h2-14H,1H3,(H,32,36)(H,33,37)/b35-34+ |
| InChIKey | KQYXGZMBFOOGEK-XAHDOWKMSA-N |
| XLogP | 5.54 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|