C28H40N4O2 — CID 5050785
N-[3-(octanoylamino)-4-phenyldiazenylphenyl]octanamide (PubChem CID 5050785) has the molecular formula C28H40N4O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is N-[3-(octanoylamino)-4-phenyldiazenylphenyl]octanamide.
| Compound Name | N-[3-(octanoylamino)-4-phenyldiazenylphenyl]octanamide |
|---|---|
| PubChem CID | 5050785 |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | N-[3-(octanoylamino)-4-phenyldiazenylphenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(/N=N/c2ccccc2)c(NC(=O)CCCCCCC)c1 |
| InChI | InChI=1S/C28H40N4O2/c1-3-5-7-9-14-18-27(33)29-24-20-21-25(32-31-23-16-12-11-13-17-23)26(22-24)30-28(34)19-15-10-8-6-4-2/h11-13,16-17,20-22H,3-10,14-15,18-19H2,1-2H3,(H,29,33)(H,30,34)/b32-31+ |
| InChIKey | KOUBUSSGJNVUQQ-QNEJGDQOSA-N |
| XLogP | 8.70 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|