C32H48N4O2 — CID 3615638
N-[3-(decanoylamino)-4-phenyldiazenylphenyl]decanamide (PubChem CID 3615638) has the molecular formula C32H48N4O2 and a molecular weight of 520.76 g/mol. Its IUPAC name is N-[3-(decanoylamino)-4-phenyldiazenylphenyl]decanamide.
| Compound Name | N-[3-(decanoylamino)-4-phenyldiazenylphenyl]decanamide |
|---|---|
| PubChem CID | 3615638 |
| Molecular Formula | C32H48N4O2 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.38 |
| IUPAC Name | N-[3-(decanoylamino)-4-phenyldiazenylphenyl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(/N=N/c2ccccc2)c(NC(=O)CCCCCCCCC)c1 |
| InChI | InChI=1S/C32H48N4O2/c1-3-5-7-9-11-13-18-22-31(37)33-28-24-25-29(36-35-27-20-16-15-17-21-27)30(26-28)34-32(38)23-19-14-12-10-8-6-4-2/h15-17,20-21,24-26H,3-14,18-19,22-23H2,1-2H3,(H,33,37)(H,34,38)/b36-35+ |
| InChIKey | QXIJGXYUHYJPOI-ULDVOPSXSA-N |
| XLogP | 10.26 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|