C15H15N3O — CID 154602849
N-(5-methyl-2-phenyldiazenylphenyl)acetamide (PubChem CID 154602849) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is N-(5-methyl-2-phenyldiazenylphenyl)acetamide.
| Compound Name | N-(5-methyl-2-phenyldiazenylphenyl)acetamide |
|---|---|
| PubChem CID | 154602849 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-(5-methyl-2-phenyldiazenylphenyl)acetamide |
| SMILES | CC(=O)Nc1cc(C)ccc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C15H15N3O/c1-11-8-9-14(15(10-11)16-12(2)19)18-17-13-6-4-3-5-7-13/h3-10H,1-2H3,(H,16,19)/b18-17+ |
| InChIKey | PNQDPIDOJCYYJN-ISLYRVAYSA-N |
| XLogP | 4.37 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|