C16H18N4O4S — CID 58112450
2-[[2-acetamido-4-(methylamino)phenyl]diazenyl]-5-methylbenzenesulfonic acid (PubChem CID 58112450) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-[[2-acetamido-4-(methylamino)phenyl]diazenyl]-5-methylbenzenesulfonic acid.
| Compound Name | 2-[[2-acetamido-4-(methylamino)phenyl]diazenyl]-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 58112450 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 2-[[2-acetamido-4-(methylamino)phenyl]diazenyl]-5-methylbenzenesulfonic acid |
| SMILES | CNc1ccc(/N=N/c2ccc(C)cc2S(=O)(=O)O)c(NC(C)=O)c1 |
| InChI | InChI=1S/C16H18N4O4S/c1-10-4-6-14(16(8-10)25(22,23)24)20-19-13-7-5-12(17-3)9-15(13)18-11(2)21/h4-9,17H,1-3H3,(H,18,21)(H,22,23,24)/b20-19+ |
| InChIKey | DXGGEFZCRHUCJA-FMQUCBEESA-N |
| XLogP | 3.66 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|