C20H20N4O4S — CID 20665071
3-[[2-(carbamoylamino)-4-methylphenyl]diazenyl]-5,7-dimethylnaphthalene-2-sulfonic acid (PubChem CID 20665071) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-[[2-(carbamoylamino)-4-methylphenyl]diazenyl]-5,7-dimethylnaphthalene-2-sulfonic acid.
| Compound Name | 3-[[2-(carbamoylamino)-4-methylphenyl]diazenyl]-5,7-dimethylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 20665071 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-[[2-(carbamoylamino)-4-methylphenyl]diazenyl]-5,7-dimethylnaphthalene-2-sulfonic acid |
| SMILES | Cc1ccc(/N=N/c2cc3c(C)cc(C)cc3cc2S(=O)(=O)O)c(NC(N)=O)c1 |
| InChI | InChI=1S/C20H20N4O4S/c1-11-4-5-16(17(8-11)22-20(21)25)23-24-18-10-15-13(3)6-12(2)7-14(15)9-19(18)29(26,27)28/h4-10H,1-3H3,(H3,21,22,25)(H,26,27,28)/b24-23+ |
| InChIKey | FNMICGFPUQQUSM-WCWDXBQESA-N |
| XLogP | 4.92 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|