C32H31ClN10O7S2 — CID 20665079
7-[[4-[[4-chloro-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-2-(phenylcarbamoylamino)phenyl]diazenyl]-3-methylnaphthalene-1,6-disulfonic acid (PubChem CID 20665079) has the molecular formula C32H31ClN10O7S2 and a molecular weight of 767.25 g/mol. Its IUPAC name is 7-[[4-[[4-chloro-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-2-(phenylcarbamoylamino)phenyl]diazenyl]-3-methylnaphthalene-1,6-disulfonic acid.
| Compound Name | 7-[[4-[[4-chloro-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-2-(phenylcarbamoylamino)phenyl]diazenyl]-3-methylnaphthalene-1,6-disulfonic acid |
|---|---|
| PubChem CID | 20665079 |
| Molecular Formula | C32H31ClN10O7S2 |
| Molecular Weight | 767.25 g/mol |
| Exact Mass | 766.15 |
| IUPAC Name | 7-[[4-[[4-chloro-6-(4-methylpiperazin-1-yl)-1,3,5-triazin-2-yl]amino]-2-(phenylcarbamoylamino)phenyl]diazenyl]-3-methylnaphthalene-1,6-disulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2cc(/N=N/c3ccc(Nc4nc(Cl)nc(N5CCN(C)CC5)n4)cc3NC(=O)Nc3ccccc3)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C32H31ClN10O7S2/c1-19-14-20-16-28(52(48,49)50)26(18-23(20)27(15-19)51(45,46)47)41-40-24-9-8-22(17-25(24)36-32(44)35-21-6-4-3-5-7-21)34-30-37-29(33)38-31(39-30)43-12-10-42(2)11-13-43/h3-9,14-18H,10-13H2,1-2H3,(H2,35,36,44)(H,45,46,47)(H,48,49,50)(H,34,37,38,39)/b41-40+ |
| InChIKey | BCPPYSYEYMASOT-CDJCAARLSA-N |
| XLogP | 6.03 |
| TPSA | 231.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.25 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|