C21H15Cl2N7O10S3 — CID 19734881
7-[[2-acetamido-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid (PubChem CID 19734881) has the molecular formula C21H15Cl2N7O10S3 and a molecular weight of 692.50 g/mol. Its IUPAC name is 7-[[2-acetamido-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | 7-[[2-acetamido-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 19734881 |
| Molecular Formula | C21H15Cl2N7O10S3 |
| Molecular Weight | 692.50 g/mol |
| Exact Mass | 690.94 |
| IUPAC Name | 7-[[2-acetamido-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
| SMILES | CC(=O)Nc1cc(Nc2nc(Cl)nc(Cl)n2)ccc1/N=N/c1cc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2cc1S(=O)(=O)O |
| InChI | InChI=1S/C21H15Cl2N7O10S3/c1-9(31)24-15-6-11(25-21-27-19(22)26-20(23)28-21)2-3-14(15)29-30-16-8-13-10(5-18(16)43(38,39)40)4-12(41(32,33)34)7-17(13)42(35,36)37/h2-8H,1H3,(H,24,31)(H,32,33,34)(H,35,36,37)(H,38,39,40)(H,25,26,27,28)/b30-29+ |
| InChIKey | DHMXPKOTHLRUGX-QVIHXGFCSA-N |
| XLogP | 4.19 |
| TPSA | 267.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|