C21H16Cl2N8O7S2 — CID 20665075
7-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-3-methylnaphthalene-1,6-disulfonic acid (PubChem CID 20665075) has the molecular formula C21H16Cl2N8O7S2 and a molecular weight of 627.45 g/mol. Its IUPAC name is 7-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-3-methylnaphthalene-1,6-disulfonic acid.
| Compound Name | 7-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-3-methylnaphthalene-1,6-disulfonic acid |
|---|---|
| PubChem CID | 20665075 |
| Molecular Formula | C21H16Cl2N8O7S2 |
| Molecular Weight | 627.45 g/mol |
| Exact Mass | 626.00 |
| IUPAC Name | 7-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-3-methylnaphthalene-1,6-disulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2cc(/N=N/c3ccc(Nc4nc(Cl)nc(Cl)n4)cc3NC(N)=O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C21H16Cl2N8O7S2/c1-9-4-10-6-17(40(36,37)38)15(8-12(10)16(5-9)39(33,34)35)31-30-13-3-2-11(7-14(13)26-20(24)32)25-21-28-18(22)27-19(23)29-21/h2-8H,1H3,(H3,24,26,32)(H,33,34,35)(H,36,37,38)(H,25,27,28,29)/b31-30+ |
| InChIKey | ZIWBJAZWIODJRC-NVQSTNCTSA-N |
| XLogP | 4.78 |
| TPSA | 239.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|