C20H14Cl2N8O10S3 — CID 139821792
8-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid (PubChem CID 139821792) has the molecular formula C20H14Cl2N8O10S3 and a molecular weight of 693.49 g/mol. Its IUPAC name is 8-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid.
| Compound Name | 8-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 139821792 |
| Molecular Formula | C20H14Cl2N8O10S3 |
| Molecular Weight | 693.49 g/mol |
| Exact Mass | 691.94 |
| IUPAC Name | 8-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]naphthalene-1,3,6-trisulfonic acid |
| SMILES | NC(=O)Nc1cc(Nc2nc(Cl)nc(Cl)n2)ccc1/N=N/c1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C20H14Cl2N8O10S3/c21-17-26-18(22)28-20(27-17)24-9-1-2-12(13(5-9)25-19(23)31)29-30-14-6-10(41(32,33)34)3-8-4-11(42(35,36)37)7-15(16(8)14)43(38,39)40/h1-7H,(H3,23,25,31)(H,32,33,34)(H,35,36,37)(H,38,39,40)(H,24,26,27,28)/b30-29+ |
| InChIKey | GYFNIPOOQLNNFE-QVIHXGFCSA-N |
| XLogP | 3.72 |
| TPSA | 293.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|