C20H14Cl2N8O13S3 — CID 88665158
[3-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5,7-disulfooxynaphthalen-2-yl] hydrogen sulfate (PubChem CID 88665158) has the molecular formula C20H14Cl2N8O13S3 and a molecular weight of 741.48 g/mol. Its IUPAC name is [3-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5,7-disulfooxynaphthalen-2-yl] hydrogen sulfate.
| Compound Name | [3-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5,7-disulfooxynaphthalen-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 88665158 |
| Molecular Formula | C20H14Cl2N8O13S3 |
| Molecular Weight | 741.48 g/mol |
| Exact Mass | 739.92 |
| IUPAC Name | [3-[[2-(carbamoylamino)-4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]diazenyl]-5,7-disulfooxynaphthalen-2-yl] hydrogen sulfate |
| SMILES | NC(=O)Nc1cc(Nc2nc(Cl)nc(Cl)n2)ccc1/N=N/c1cc2c(OS(=O)(=O)O)cc(OS(=O)(=O)O)cc2cc1OS(=O)(=O)O |
| InChI | InChI=1S/C20H14Cl2N8O13S3/c21-17-26-18(22)28-20(27-17)24-9-1-2-12(13(5-9)25-19(23)31)29-30-14-7-11-8(4-16(14)43-46(38,39)40)3-10(41-44(32,33)34)6-15(11)42-45(35,36)37/h1-7H,(H3,23,25,31)(H,32,33,34)(H,35,36,37)(H,38,39,40)(H,24,26,27,28)/b30-29+ |
| InChIKey | KPIIFZIFCNJBFD-QVIHXGFCSA-N |
| XLogP | 3.53 |
| TPSA | 321.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|