C28H22ClN9O9S3 — CID 90368836
5-[[2-(carbamoylamino)-4-[[4-chloro-6-(5-ethenylsulfonyl-2-sulfoanilino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 90368836) has the molecular formula C28H22ClN9O9S3 and a molecular weight of 760.19 g/mol. Its IUPAC name is 5-[[2-(carbamoylamino)-4-[[4-chloro-6-(5-ethenylsulfonyl-2-sulfoanilino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 5-[[2-(carbamoylamino)-4-[[4-chloro-6-(5-ethenylsulfonyl-2-sulfoanilino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 90368836 |
| Molecular Formula | C28H22ClN9O9S3 |
| Molecular Weight | 760.19 g/mol |
| Exact Mass | 759.04 |
| IUPAC Name | 5-[[2-(carbamoylamino)-4-[[4-chloro-6-(5-ethenylsulfonyl-2-sulfoanilino)-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | C=CS(=O)(=O)c1ccc(S(=O)(=O)O)c(Nc2nc(Cl)nc(Nc3ccc(/N=N/c4cccc5c(S(=O)(=O)O)cccc45)c(NC(N)=O)c3)n2)c1 |
| InChI | InChI=1S/C28H22ClN9O9S3/c1-2-48(40,41)16-10-12-24(50(45,46)47)22(14-16)33-28-35-25(29)34-27(36-28)31-15-9-11-20(21(13-15)32-26(30)39)38-37-19-7-3-6-18-17(19)5-4-8-23(18)49(42,43)44/h2-14H,1H2,(H3,30,32,39)(H,42,43,44)(H,45,46,47)(H2,31,33,34,35,36)/b38-37+ |
| InChIKey | FRJRFVIKWUZVHY-HEFFKOSUSA-N |
| XLogP | 5.48 |
| TPSA | 285.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.19 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|