C18H17N5O10S3 — CID 20741797
4-[[2-(carbamoylamino)-4-(methylamino)phenyl]diazenyl]-5-(trioxidanylsulfanyl)naphthalene-2,7-disulfonic acid (PubChem CID 20741797) has the molecular formula C18H17N5O10S3 and a molecular weight of 559.56 g/mol. Its IUPAC name is 4-[[2-(carbamoylamino)-4-(methylamino)phenyl]diazenyl]-5-(trioxidanylsulfanyl)naphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[2-(carbamoylamino)-4-(methylamino)phenyl]diazenyl]-5-(trioxidanylsulfanyl)naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 20741797 |
| Molecular Formula | C18H17N5O10S3 |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | 4-[[2-(carbamoylamino)-4-(methylamino)phenyl]diazenyl]-5-(trioxidanylsulfanyl)naphthalene-2,7-disulfonic acid |
| SMILES | CNc1ccc(/N=N/c2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(SOOO)c23)c(NC(N)=O)c1 |
| InChI | InChI=1S/C18H17N5O10S3/c1-20-10-2-3-13(14(6-10)21-18(19)24)22-23-15-7-11(35(26,27)28)4-9-5-12(36(29,30)31)8-16(17(9)15)34-33-32-25/h2-8,20,25H,1H3,(H3,19,21,24)(H,26,27,28)(H,29,30,31)/b23-22+ |
| InChIKey | NWHLROXROZTNQP-GHVJWSGMSA-N |
| XLogP | 3.71 |
| TPSA | 239.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|