C17H12ClF2N7O7S2 — CID 59836714
2-[[2-(carbamoylamino)-4-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]phenyl]diazenyl]-5-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 59836714) has the molecular formula C17H12ClF2N7O7S2 and a molecular weight of 563.91 g/mol. Its IUPAC name is 2-[[2-(carbamoylamino)-4-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]phenyl]diazenyl]-5-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 2-[[2-(carbamoylamino)-4-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]phenyl]diazenyl]-5-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 59836714 |
| Molecular Formula | C17H12ClF2N7O7S2 |
| Molecular Weight | 563.91 g/mol |
| Exact Mass | 562.99 |
| IUPAC Name | 2-[[2-(carbamoylamino)-4-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]phenyl]diazenyl]-5-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | NC(=O)Nc1cc(Nc2nc(F)nc(F)c2Cl)ccc1/N=N/c1ccc(SOOO)cc1S(=O)(=O)O |
| InChI | InChI=1S/C17H12ClF2N7O7S2/c18-13-14(19)24-16(20)25-15(13)22-7-1-3-9(11(5-7)23-17(21)28)26-27-10-4-2-8(35-34-33-29)6-12(10)36(30,31)32/h1-6,29H,(H3,21,23,28)(H,22,24,25)(H,30,31,32)/b27-26+ |
| InChIKey | BVHMWYPTBVONJU-CYYJNZCTSA-N |
| XLogP | 4.73 |
| TPSA | 210.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|