C21H12ClF2N5O8S3 — CID 136762800
7-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]-4-hydroxy-3-[(4-methyl-3,6-disulfonylcyclohexa-1,4-dien-1-yl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 136762800) has the molecular formula C21H12ClF2N5O8S3 and a molecular weight of 632.00 g/mol. Its IUPAC name is 7-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]-4-hydroxy-3-[(4-methyl-3,6-disulfonylcyclohexa-1,4-dien-1-yl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]-4-hydroxy-3-[(4-methyl-3,6-disulfonylcyclohexa-1,4-dien-1-yl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 136762800 |
| Molecular Formula | C21H12ClF2N5O8S3 |
| Molecular Weight | 632.00 g/mol |
| Exact Mass | 630.95 |
| IUPAC Name | 7-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]-4-hydroxy-3-[(4-methyl-3,6-disulfonylcyclohexa-1,4-dien-1-yl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | CC1=CC(=S(=O)=O)C(/N=N/c2c(S(=O)(=O)O)cc3cc(Nc4nc(F)nc(F)c4Cl)ccc3c2O)=CC1=S(=O)=O |
| InChI | InChI=1S/C21H12ClF2N5O8S3/c1-8-4-14(39(33)34)12(7-13(8)38(31)32)28-29-17-15(40(35,36)37)6-9-5-10(2-3-11(9)18(17)30)25-20-16(22)19(23)26-21(24)27-20/h2-7,30H,1H3,(H,25,26,27)(H,35,36,37)/b29-28+ |
| InChIKey | ZBEWQEJMOQUMEY-ZQHSETAFSA-N |
| XLogP | 3.29 |
| TPSA | 205.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.00 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|