C26H32N10O5S — CID 165363660
7-[[4,6-bis(2-aminopropan-2-ylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-methoxyphenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 165363660) has the molecular formula C26H32N10O5S and a molecular weight of 596.67 g/mol. Its IUPAC name is 7-[[4,6-bis(2-aminopropan-2-ylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-methoxyphenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-[[4,6-bis(2-aminopropan-2-ylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-methoxyphenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 165363660 |
| Molecular Formula | C26H32N10O5S |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 7-[[4,6-bis(2-aminopropan-2-ylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-methoxyphenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1ccccc1/N=N/c1c(S(=O)(=O)O)cc2cc(Nc3nc(NC(C)(C)N)nc(NC(C)(C)N)n3)ccc2c1O |
| InChI | InChI=1S/C26H32N10O5S/c1-25(2,27)33-23-30-22(31-24(32-23)34-26(3,4)28)29-15-10-11-16-14(12-15)13-19(42(38,39)40)20(21(16)37)36-35-17-8-6-7-9-18(17)41-5/h6-13,37H,27-28H2,1-5H3,(H,38,39,40)(H3,29,30,31,32,33,34)/b36-35+ |
| InChIKey | IYLGTJAGPGCYSH-ULDVOPSXSA-N |
| XLogP | 4.36 |
| TPSA | 235.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|