C27H35N11O7S2 — CID 135443669
7-[[4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-methoxy-5-methyl-4-sulfamoylphenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 135443669) has the molecular formula C27H35N11O7S2 and a molecular weight of 689.78 g/mol. Its IUPAC name is 7-[[4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-methoxy-5-methyl-4-sulfamoylphenyl)diazenyl]naphthalene-2-sulfonic acid.
| Compound Name | 7-[[4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-methoxy-5-methyl-4-sulfamoylphenyl)diazenyl]naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 135443669 |
| Molecular Formula | C27H35N11O7S2 |
| Molecular Weight | 689.78 g/mol |
| Exact Mass | 689.22 |
| IUPAC Name | 7-[[4,6-bis(2-aminopropylamino)-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-[(2-methoxy-5-methyl-4-sulfamoylphenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | COc1cc(S(N)(=O)=O)c(C)cc1/N=N/c1c(S(=O)(=O)O)cc2cc(Nc3nc(NCC(C)N)nc(NCC(C)N)n3)ccc2c1O |
| InChI | InChI=1S/C27H35N11O7S2/c1-13-7-19(20(45-4)10-21(13)46(30,40)41)37-38-23-22(47(42,43)44)9-16-8-17(5-6-18(16)24(23)39)33-27-35-25(31-11-14(2)28)34-26(36-27)32-12-15(3)29/h5-10,14-15,39H,11-12,28-29H2,1-4H3,(H2,30,40,41)(H,42,43,44)(H3,31,32,33,34,35,36)/b38-37+ |
| InChIKey | WFHGALWBRCIKIY-HEFFKOSUSA-N |
| XLogP | 2.62 |
| TPSA | 295.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.78 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|