C22H22N6O7S2 — CID 23546625
3-[[4-[[2-(carbamoylamino)-4-methylphenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 23546625) has the molecular formula C22H22N6O7S2 and a molecular weight of 546.59 g/mol. Its IUPAC name is 3-[[4-[[2-(carbamoylamino)-4-methylphenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 3-[[4-[[2-(carbamoylamino)-4-methylphenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 23546625 |
| Molecular Formula | C22H22N6O7S2 |
| Molecular Weight | 546.59 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | 3-[[4-[[2-(carbamoylamino)-4-methylphenyl]diazenyl]-2,5-dimethylphenyl]diazenyl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | Cc1ccc(/N=N/c2cc(C)c(/N=N/c3cc(S(=O)(=O)O)ccc3SOOO)cc2C)c(NC(N)=O)c1 |
| InChI | InChI=1S/C22H22N6O7S2/c1-12-4-6-16(19(8-12)24-22(23)29)25-26-17-9-14(3)18(10-13(17)2)27-28-20-11-15(37(31,32)33)5-7-21(20)36-35-34-30/h4-11,30H,1-3H3,(H3,23,24,29)(H,31,32,33)/b26-25+,28-27+ |
| InChIKey | FHZUTOKUXVMZNB-PAMTUDGESA-N |
| XLogP | 6.61 |
| TPSA | 197.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|