C18H16N2O6S2 — CID 58914091
4-methyl-3-[[4-methyl-7-(trioxidanylsulfanyl)naphthalen-1-yl]diazenyl]benzenesulfonic acid (PubChem CID 58914091) has the molecular formula C18H16N2O6S2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-methyl-3-[[4-methyl-7-(trioxidanylsulfanyl)naphthalen-1-yl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-methyl-3-[[4-methyl-7-(trioxidanylsulfanyl)naphthalen-1-yl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58914091 |
| Molecular Formula | C18H16N2O6S2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 4-methyl-3-[[4-methyl-7-(trioxidanylsulfanyl)naphthalen-1-yl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1/N=N/c1ccc(C)c2ccc(SOOO)cc12 |
| InChI | InChI=1S/C18H16N2O6S2/c1-11-4-8-17(16-9-13(27-26-25-21)5-7-15(11)16)19-20-18-10-14(28(22,23)24)6-3-12(18)2/h3-10,21H,1-2H3,(H,22,23,24)/b20-19+ |
| InChIKey | ZAENJKRDXOEWBY-FMQUCBEESA-N |
| XLogP | 5.55 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|