C11H10O7S2 — CID 58651758
5-hydroxy-2-methyl-7-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid (PubChem CID 58651758) has the molecular formula C11H10O7S2 and a molecular weight of 318.33 g/mol. Its IUPAC name is 5-hydroxy-2-methyl-7-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid.
| Compound Name | 5-hydroxy-2-methyl-7-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 58651758 |
| Molecular Formula | C11H10O7S2 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 5-hydroxy-2-methyl-7-(trioxidanylsulfanyl)naphthalene-1-sulfonic acid |
| SMILES | Cc1ccc2c(O)cc(SOOO)cc2c1S(=O)(=O)O |
| InChI | InChI=1S/C11H10O7S2/c1-6-2-3-8-9(11(6)20(14,15)16)4-7(5-10(8)12)19-18-17-13/h2-5,12-13H,1H3,(H,14,15,16) |
| InChIKey | RPMAMVCYUWLDBG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|