C27H21N3O16S5 — CID 158039790
2-[[1-amino-8-hydroxy-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-(4-methylphenyl)sulfanyloxynaphthalene-1,7-disulfonic acid;molecular oxygen (PubChem CID 158039790) has the molecular formula C27H21N3O16S5 and a molecular weight of 803.80 g/mol. Its IUPAC name is 2-[[1-amino-8-hydroxy-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-(4-methylphenyl)sulfanyloxynaphthalene-1,7-disulfonic acid;molecular oxygen.
| Compound Name | 2-[[1-amino-8-hydroxy-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-(4-methylphenyl)sulfanyloxynaphthalene-1,7-disulfonic acid;molecular oxygen |
|---|---|
| PubChem CID | 158039790 |
| Molecular Formula | C27H21N3O16S5 |
| Molecular Weight | 803.80 g/mol |
| Exact Mass | 802.95 |
| IUPAC Name | 2-[[1-amino-8-hydroxy-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-(4-methylphenyl)sulfanyloxynaphthalene-1,7-disulfonic acid;molecular oxygen |
| SMILES | Cc1ccc(SOc2cc(S(=O)(=O)O)cc3c(S(=O)(=O)O)c(/N=N/c4cc(S(=O)(=O)O)c5cc(SOOO)cc(O)c5c4N)ccc23)cc1.O=O |
| InChI | InChI=1S/C27H21N3O14S5.O2/c1-13-2-4-14(5-3-13)45-42-23-11-16(47(33,34)35)10-18-17(23)6-7-20(27(18)49(39,40)41)29-30-21-12-24(48(36,37)38)19-8-15(46-44-43-32)9-22(31)25(19)26(21)28;1-2/h2-12,31-32H,28H2,1H3,(H,33,34,35)(H,36,37,38)(H,39,40,41);/b30-29+; |
| InChIKey | FIFACLFCPHIJNT-BXGDTPBJSA-N |
| XLogP | 6.33 |
| TPSA | 316.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.80 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|