C26H18N6O19S5 — CID 135982506
2-[[1-amino-8-hydroxy-7-[(4-nitro-2-sulfophenyl)diazenyl]-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid (PubChem CID 135982506) has the molecular formula C26H18N6O19S5 and a molecular weight of 878.79 g/mol. Its IUPAC name is 2-[[1-amino-8-hydroxy-7-[(4-nitro-2-sulfophenyl)diazenyl]-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid.
| Compound Name | 2-[[1-amino-8-hydroxy-7-[(4-nitro-2-sulfophenyl)diazenyl]-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 135982506 |
| Molecular Formula | C26H18N6O19S5 |
| Molecular Weight | 878.79 g/mol |
| Exact Mass | 877.92 |
| IUPAC Name | 2-[[1-amino-8-hydroxy-7-[(4-nitro-2-sulfophenyl)diazenyl]-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc3c(O)cc(S(=O)(=O)O)cc3c2S(=O)(=O)O)cc(S(=O)(=O)O)c2cc(SOOO)c(/N=N/c3ccc([N+](=O)[O-])cc3S(=O)(=O)O)c(O)c12 |
| InChI | InChI=1S/C26H18N6O19S5/c27-23-17(30-29-16-4-2-12-13(26(16)56(47,48)49)6-11(7-18(12)33)53(38,39)40)9-20(54(41,42)43)14-8-19(52-51-50-37)24(25(34)22(14)23)31-28-15-3-1-10(32(35)36)5-21(15)55(44,45)46/h1-9,33-34,37H,27H2,(H,38,39,40)(H,41,42,43)(H,44,45,46)(H,47,48,49)/b30-29+,31-28+ |
| InChIKey | MQRKZIPIKBTGPT-JZXBUVORSA-N |
| XLogP | 5.14 |
| TPSA | 415.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.79 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|