C32H23N7O14S4 — CID 135982484
2-[[1-amino-8-hydroxy-7-phenyldiazenyl-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-1,7-disulfonic acid (PubChem CID 135982484) has the molecular formula C32H23N7O14S4 and a molecular weight of 857.84 g/mol. Its IUPAC name is 2-[[1-amino-8-hydroxy-7-phenyldiazenyl-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-1,7-disulfonic acid.
| Compound Name | 2-[[1-amino-8-hydroxy-7-phenyldiazenyl-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 135982484 |
| Molecular Formula | C32H23N7O14S4 |
| Molecular Weight | 857.84 g/mol |
| Exact Mass | 857.02 |
| IUPAC Name | 2-[[1-amino-8-hydroxy-7-phenyldiazenyl-4-sulfo-6-(trioxidanylsulfanyl)naphthalen-2-yl]diazenyl]-5-hydroxy-6-phenyldiazenylnaphthalene-1,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc3c(O)c(/N=N/c4ccccc4)c(S(=O)(=O)O)cc3c2S(=O)(=O)O)cc(S(=O)(=O)O)c2cc(SOOO)c(/N=N/c3ccccc3)c(O)c12 |
| InChI | InChI=1S/C32H23N7O14S4/c33-27-22(15-24(55(43,44)45)20-13-23(54-53-52-42)28(31(41)26(20)27)38-34-16-7-3-1-4-8-16)37-36-21-12-11-18-19(32(21)57(49,50)51)14-25(56(46,47)48)29(30(18)40)39-35-17-9-5-2-6-10-17/h1-15,40-42H,33H2,(H,43,44,45)(H,46,47,48)(H,49,50,51)/b37-36+,38-34+,39-35+ |
| InChIKey | GUXZZSFHJYFTDQ-WSXWKEHXSA-N |
| XLogP | 8.40 |
| TPSA | 342.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.84 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|