C38H27N9O11S3 — CID 137130409
2-[(1-amino-8-hydroxy-7-phenyldiazenyl-4-sulfonaphthalen-2-yl)diazenyl]-5-hydroxy-6-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,7-disulfonic acid (PubChem CID 137130409) has the molecular formula C38H27N9O11S3 and a molecular weight of 881.89 g/mol. Its IUPAC name is 2-[(1-amino-8-hydroxy-7-phenyldiazenyl-4-sulfonaphthalen-2-yl)diazenyl]-5-hydroxy-6-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,7-disulfonic acid.
| Compound Name | 2-[(1-amino-8-hydroxy-7-phenyldiazenyl-4-sulfonaphthalen-2-yl)diazenyl]-5-hydroxy-6-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 137130409 |
| Molecular Formula | C38H27N9O11S3 |
| Molecular Weight | 881.89 g/mol |
| Exact Mass | 881.10 |
| IUPAC Name | 2-[(1-amino-8-hydroxy-7-phenyldiazenyl-4-sulfonaphthalen-2-yl)diazenyl]-5-hydroxy-6-[(4-phenyldiazenylphenyl)diazenyl]naphthalene-1,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2ccc3c(O)c(/N=N/c4ccc(/N=N/c5ccccc5)cc4)c(S(=O)(=O)O)cc3c2S(=O)(=O)O)cc(S(=O)(=O)O)c2ccc(/N=N/c3ccccc3)c(O)c12 |
| InChI | InChI=1S/C38H27N9O11S3/c39-34-30(20-31(59(50,51)52)26-16-17-28(37(49)33(26)34)44-42-22-9-5-2-6-10-22)46-45-29-18-15-25-27(38(29)61(56,57)58)19-32(60(53,54)55)35(36(25)48)47-43-24-13-11-23(12-14-24)41-40-21-7-3-1-4-8-21/h1-20,48-49H,39H2,(H,50,51,52)(H,53,54,55)(H,56,57,58)/b41-40+,44-42+,46-45+,47-43+ |
| InChIKey | GHNPNAACLAVCQY-SZQKWGFMSA-N |
| XLogP | 10.39 |
| TPSA | 328.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.89 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|