C26H19N5O7S2 — CID 136688709
4-amino-5-hydroxy-6-(naphthalen-1-yldiazenyl)-3-phenyldiazenylnaphthalene-1,7-disulfonic acid (PubChem CID 136688709) has the molecular formula C26H19N5O7S2 and a molecular weight of 577.60 g/mol. Its IUPAC name is 4-amino-5-hydroxy-6-(naphthalen-1-yldiazenyl)-3-phenyldiazenylnaphthalene-1,7-disulfonic acid.
| Compound Name | 4-amino-5-hydroxy-6-(naphthalen-1-yldiazenyl)-3-phenyldiazenylnaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 136688709 |
| Molecular Formula | C26H19N5O7S2 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | 4-amino-5-hydroxy-6-(naphthalen-1-yldiazenyl)-3-phenyldiazenylnaphthalene-1,7-disulfonic acid |
| SMILES | Nc1c(/N=N/c2ccccc2)cc(S(=O)(=O)O)c2cc(S(=O)(=O)O)c(/N=N/c3cccc4ccccc34)c(O)c12 |
| InChI | InChI=1S/C26H19N5O7S2/c27-24-20(30-28-16-9-2-1-3-10-16)14-21(39(33,34)35)18-13-22(40(36,37)38)25(26(32)23(18)24)31-29-19-12-6-8-15-7-4-5-11-17(15)19/h1-14,32H,27H2,(H,33,34,35)(H,36,37,38)/b30-28+,31-29+ |
| InChIKey | KASPLMJUPWGDRY-FUEWEDNTSA-N |
| XLogP | 6.61 |
| TPSA | 204.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|