C27H21N5O13S3 — CID 135997780
2-[[7-[[1-amino-8-hydroxy-4-sulfo-6-(trihydroxy-λ4-sulfanyl)naphthalen-2-yl]diazenyl]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]benzoic acid (PubChem CID 135997780) has the molecular formula C27H21N5O13S3 and a molecular weight of 719.69 g/mol. Its IUPAC name is 2-[[7-[[1-amino-8-hydroxy-4-sulfo-6-(trihydroxy-λ4-sulfanyl)naphthalen-2-yl]diazenyl]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]benzoic acid.
| Compound Name | 2-[[7-[[1-amino-8-hydroxy-4-sulfo-6-(trihydroxy-λ4-sulfanyl)naphthalen-2-yl]diazenyl]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 135997780 |
| Molecular Formula | C27H21N5O13S3 |
| Molecular Weight | 719.69 g/mol |
| Exact Mass | 719.03 |
| IUPAC Name | 2-[[7-[[1-amino-8-hydroxy-4-sulfo-6-(trihydroxy-λ4-sulfanyl)naphthalen-2-yl]diazenyl]-1-hydroxy-3-sulfonaphthalen-2-yl]diazenyl]benzoic acid |
| SMILES | Nc1c(/N=N/c2ccc3cc(S(=O)(=O)O)c(/N=N/c4ccccc4C(=O)O)c(O)c3c2)cc(S(=O)(=O)O)c2cc(S(O)(O)O)cc(O)c12 |
| InChI | InChI=1S/C27H21N5O13S3/c28-24-19(11-21(47(40,41)42)17-9-14(46(37,38)39)10-20(33)23(17)24)31-29-13-6-5-12-7-22(48(43,44)45)25(26(34)16(12)8-13)32-30-18-4-2-1-3-15(18)27(35)36/h1-11,33-34,37-39H,28H2,(H,35,36)(H,40,41,42)(H,43,44,45)/b31-29+,32-30+ |
| InChIKey | XBVNKCKVNMCIMD-JWTBXLROSA-N |
| XLogP | 6.59 |
| TPSA | 322.65 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.69 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|