C21H14N2O9S2 — CID 136855518
4-[(6,8-disulfonaphthalen-2-yl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid (PubChem CID 136855518) has the molecular formula C21H14N2O9S2 and a molecular weight of 502.48 g/mol. Its IUPAC name is 4-[(6,8-disulfonaphthalen-2-yl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | 4-[(6,8-disulfonaphthalen-2-yl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 136855518 |
| Molecular Formula | C21H14N2O9S2 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.01 |
| IUPAC Name | 4-[(6,8-disulfonaphthalen-2-yl)diazenyl]-3-hydroxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2c(/N=N/c2ccc3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c3c2)c1O |
| InChI | InChI=1S/C21H14N2O9S2/c24-20-17(21(25)26)8-11-3-1-2-4-15(11)19(20)23-22-13-6-5-12-7-14(33(27,28)29)10-18(16(12)9-13)34(30,31)32/h1-10,24H,(H,25,26)(H,27,28,29)(H,30,31,32)/b23-22+ |
| InChIKey | SENIBUSBCDWEMU-GHVJWSGMSA-N |
| XLogP | 4.31 |
| TPSA | 190.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|