C23H16N4O9S2 — CID 136640607
2-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-5-[(4-sulfophenyl)diazenyl]benzoic acid (PubChem CID 136640607) has the molecular formula C23H16N4O9S2 and a molecular weight of 556.53 g/mol. Its IUPAC name is 2-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-5-[(4-sulfophenyl)diazenyl]benzoic acid.
| Compound Name | 2-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-5-[(4-sulfophenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136640607 |
| Molecular Formula | C23H16N4O9S2 |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | 2-[(1-hydroxy-4-sulfonaphthalen-2-yl)diazenyl]-5-[(4-sulfophenyl)diazenyl]benzoic acid |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(S(=O)(=O)O)cc2)ccc1/N=N/c1cc(S(=O)(=O)O)c2ccccc2c1O |
| InChI | InChI=1S/C23H16N4O9S2/c28-22-17-4-2-1-3-16(17)21(38(34,35)36)12-20(22)27-26-19-10-7-14(11-18(19)23(29)30)25-24-13-5-8-15(9-6-13)37(31,32)33/h1-12,28H,(H,29,30)(H,31,32,33)(H,34,35,36)/b25-24+,27-26+ |
| InChIKey | KAYVVNBEMDAHDB-JQRDNDPDSA-N |
| XLogP | 5.57 |
| TPSA | 215.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|