C26H17N7O8S — CID 136640593
2-[[4-(4,6-dihydroxy-1,3,5-triazin-2-yl)-1-hydroxynaphthalen-2-yl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzoic acid (PubChem CID 136640593) has the molecular formula C26H17N7O8S and a molecular weight of 587.53 g/mol. Its IUPAC name is 2-[[4-(4,6-dihydroxy-1,3,5-triazin-2-yl)-1-hydroxynaphthalen-2-yl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzoic acid.
| Compound Name | 2-[[4-(4,6-dihydroxy-1,3,5-triazin-2-yl)-1-hydroxynaphthalen-2-yl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 136640593 |
| Molecular Formula | C26H17N7O8S |
| Molecular Weight | 587.53 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | 2-[[4-(4,6-dihydroxy-1,3,5-triazin-2-yl)-1-hydroxynaphthalen-2-yl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzoic acid |
| SMILES | O=C(O)c1cc(/N=N/c2ccc(S(=O)(=O)O)cc2)ccc1/N=N/c1cc(-c2nc(O)nc(O)n2)c2ccccc2c1O |
| InChI | InChI=1S/C26H17N7O8S/c34-22-17-4-2-1-3-16(17)18(23-27-25(37)29-26(38)28-23)12-21(22)33-32-20-10-7-14(11-19(20)24(35)36)31-30-13-5-8-15(9-6-13)42(39,40)41/h1-12,34H,(H,35,36)(H,39,40,41)(H2,27,28,29,37,38)/b31-30+,33-32+ |
| InChIKey | NFLNEFNVDDCDSA-CJQWSLHQSA-N |
| XLogP | 5.58 |
| TPSA | 240.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|