C19H14N2O6S — CID 175871554
2-(2-hydroxy-3-phenyldiazenyl-5-sulfophenyl)benzoic acid (PubChem CID 175871554) has the molecular formula C19H14N2O6S and a molecular weight of 398.40 g/mol. Its IUPAC name is 2-(2-hydroxy-3-phenyldiazenyl-5-sulfophenyl)benzoic acid.
| Compound Name | 2-(2-hydroxy-3-phenyldiazenyl-5-sulfophenyl)benzoic acid |
|---|---|
| PubChem CID | 175871554 |
| Molecular Formula | C19H14N2O6S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-(2-hydroxy-3-phenyldiazenyl-5-sulfophenyl)benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1cc(S(=O)(=O)O)cc(/N=N/c2ccccc2)c1O |
| InChI | InChI=1S/C19H14N2O6S/c22-18-16(14-8-4-5-9-15(14)19(23)24)10-13(28(25,26)27)11-17(18)21-20-12-6-2-1-3-7-12/h1-11,22H,(H,23,24)(H,25,26,27)/b21-20+ |
| InChIKey | CTVBGJKKOIKUKC-QZQOTICOSA-N |
| XLogP | 4.42 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|