C12H10N2O12S4 — CID 178182870
5-phenyldiazenylbenzene-1,2,3,4-tetrasulfonic acid (PubChem CID 178182870) has the molecular formula C12H10N2O12S4 and a molecular weight of 502.48 g/mol. Its IUPAC name is 5-phenyldiazenylbenzene-1,2,3,4-tetrasulfonic acid.
| Compound Name | 5-phenyldiazenylbenzene-1,2,3,4-tetrasulfonic acid |
|---|---|
| PubChem CID | 178182870 |
| Molecular Formula | C12H10N2O12S4 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 501.91 |
| IUPAC Name | 5-phenyldiazenylbenzene-1,2,3,4-tetrasulfonic acid |
| SMILES | O=S(=O)(O)c1cc(/N=N/c2ccccc2)c(S(=O)(=O)O)c(S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C12H10N2O12S4/c15-27(16,17)9-6-8(14-13-7-4-2-1-3-5-7)10(28(18,19)20)12(30(24,25)26)11(9)29(21,22)23/h1-6H,(H,15,16,17)(H,18,19,20)(H,21,22,23)(H,24,25,26)/b14-13+ |
| InChIKey | GMOCNGFCTJYGLG-BUHFOSPRSA-N |
| XLogP | 1.09 |
| TPSA | 242.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|