C28H21N7O7S2 — CID 136855575
3-[[4-[(2-amino-5-hydroxyphenyl)diazenyl]phenyl]diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonic acid (PubChem CID 136855575) has the molecular formula C28H21N7O7S2 and a molecular weight of 631.65 g/mol. Its IUPAC name is 3-[[4-[(2-amino-5-hydroxyphenyl)diazenyl]phenyl]diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonic acid.
| Compound Name | 3-[[4-[(2-amino-5-hydroxyphenyl)diazenyl]phenyl]diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 136855575 |
| Molecular Formula | C28H21N7O7S2 |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 631.09 |
| IUPAC Name | 3-[[4-[(2-amino-5-hydroxyphenyl)diazenyl]phenyl]diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonic acid |
| SMILES | Nc1ccc(O)cc1/N=N/c1ccc(/N=N/c2cc3cc(/N=N/c4ccccc4)c(S(=O)(=O)O)cc3cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C28H21N7O7S2/c29-23-11-10-22(36)16-24(23)33-31-20-6-8-21(9-7-20)32-35-26-13-17-12-25(34-30-19-4-2-1-3-5-19)27(43(37,38)39)14-18(17)15-28(26)44(40,41)42/h1-16,36H,29H2,(H,37,38,39)(H,40,41,42)/b33-31+,34-30+,35-32+ |
| InChIKey | MPRPKAZFXDCVSY-QUIDAXOYSA-N |
| XLogP | 7.87 |
| TPSA | 229.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|