C22H16N4O7S2 — CID 137218994
3-[(3-hydroxy-2-phenyldiazenylphenyl)diazenyl]naphthalene-2,7-disulfonic acid (PubChem CID 137218994) has the molecular formula C22H16N4O7S2 and a molecular weight of 512.53 g/mol. Its IUPAC name is 3-[(3-hydroxy-2-phenyldiazenylphenyl)diazenyl]naphthalene-2,7-disulfonic acid.
| Compound Name | 3-[(3-hydroxy-2-phenyldiazenylphenyl)diazenyl]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 137218994 |
| Molecular Formula | C22H16N4O7S2 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 3-[(3-hydroxy-2-phenyldiazenylphenyl)diazenyl]naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2cc(/N=N/c3cccc(O)c3/N=N/c3ccccc3)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C22H16N4O7S2/c27-20-8-4-7-18(22(20)26-23-16-5-2-1-3-6-16)24-25-19-12-14-9-10-17(34(28,29)30)11-15(14)13-21(19)35(31,32)33/h1-13,27H,(H,28,29,30)(H,31,32,33)/b25-24+,26-23+ |
| InChIKey | RRQIQCYVVWCNKK-GDNNORCTSA-N |
| XLogP | 5.87 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|