C16H10N2Na2O6S2 — CID 162224475
disodium;3-phenyldiazenylnaphthalene-2,7-disulfonate (PubChem CID 162224475) has the molecular formula C16H10N2Na2O6S2 and a molecular weight of 436.38 g/mol. Its IUPAC name is disodium;3-phenyldiazenylnaphthalene-2,7-disulfonate.
| Compound Name | disodium;3-phenyldiazenylnaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 162224475 |
| Molecular Formula | C16H10N2Na2O6S2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | disodium;3-phenyldiazenylnaphthalene-2,7-disulfonate |
| SMILES | O=S(=O)([O-])c1ccc2cc(/N=N/c3ccccc3)c(S(=O)(=O)[O-])cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C16H12N2O6S2.2Na/c19-25(20,21)14-7-6-11-9-15(18-17-13-4-2-1-3-5-13)16(26(22,23)24)10-12(11)8-14;;/h1-10H,(H,19,20,21)(H,22,23,24);;/q;2*+1/p-2/b18-17+;; |
| InChIKey | ZUOIPCGYJCLHEB-QIKYXUGXSA-L |
| XLogP | -2.93 |
| TPSA | 139.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|