C23H15N5Na2O8S2 — CID 102067134
disodium;3-[(2-methyl-5-nitrophenyl)diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonate (PubChem CID 102067134) has the molecular formula C23H15N5Na2O8S2 and a molecular weight of 599.51 g/mol. Its IUPAC name is disodium;3-[(2-methyl-5-nitrophenyl)diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonate.
| Compound Name | disodium;3-[(2-methyl-5-nitrophenyl)diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 102067134 |
| Molecular Formula | C23H15N5Na2O8S2 |
| Molecular Weight | 599.51 g/mol |
| Exact Mass | 599.02 |
| IUPAC Name | disodium;3-[(2-methyl-5-nitrophenyl)diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1/N=N/c1cc2cc(/N=N/c3ccccc3)c(S(=O)(=O)[O-])cc2cc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C23H17N5O8S2.2Na/c1-14-7-8-18(28(29)30)13-19(14)25-27-21-10-15-9-20(26-24-17-5-3-2-4-6-17)22(37(31,32)33)11-16(15)12-23(21)38(34,35)36;;/h2-13H,1H3,(H,31,32,33)(H,34,35,36);;/q;2*+1/p-2/b26-24+,27-25+;; |
| InChIKey | UCOODVCVRSURNE-SRJQXOPESA-L |
| XLogP | -0.30 |
| TPSA | 206.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.51 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|