C22H13N3Na2O9S2 — CID 175871458
disodium;4-hydroxy-5-[(4-nitrophenyl)diazenyl]-3-phenylnaphthalene-2,7-disulfonate (PubChem CID 175871458) has the molecular formula C22H13N3Na2O9S2 and a molecular weight of 573.47 g/mol. Its IUPAC name is disodium;4-hydroxy-5-[(4-nitrophenyl)diazenyl]-3-phenylnaphthalene-2,7-disulfonate.
| Compound Name | disodium;4-hydroxy-5-[(4-nitrophenyl)diazenyl]-3-phenylnaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 175871458 |
| Molecular Formula | C22H13N3Na2O9S2 |
| Molecular Weight | 573.47 g/mol |
| Exact Mass | 572.99 |
| IUPAC Name | disodium;4-hydroxy-5-[(4-nitrophenyl)diazenyl]-3-phenylnaphthalene-2,7-disulfonate |
| SMILES | O=[N+]([O-])c1ccc(/N=N/c2cc(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])c(-c4ccccc4)c(O)c23)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C22H15N3O9S2.2Na/c26-22-20-14(11-19(36(32,33)34)21(22)13-4-2-1-3-5-13)10-17(35(29,30)31)12-18(20)24-23-15-6-8-16(9-7-15)25(27)28;;/h1-12,26H,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2/b24-23+;; |
| InChIKey | NZIVNGQDCUIYIZ-KPOOZVEVSA-L |
| XLogP | -1.65 |
| TPSA | 202.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.47 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|