About 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene
4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene (PubChem CID 174911853) has the molecular formula C19H17N3O5S
and a molecular weight of 399.43 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene |
| PubChem CID | 174911853 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=[N+]([O-])c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C12H9N3O2.C7H8O3S/c16-15(17)12-8-6-11(7-9-12)14-13-10-4-2-1-3-5-10;1-6-2-4-7(5-3-6)11(8,9)10/h1-9H;2-5H,1H3,(H,8,9,10)/b14-13+; |
| InChIKey | ZUAAQOVSQKCQAJ-IERUDJENSA-N |
| XLogP | 5.25 |
| TPSA | 122.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene?
The IUPAC name of 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene (CID 174911853) is 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene.
What is the SMILES notation for 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene?
The canonical SMILES for 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene is Cc1ccc(S(=O)(=O)O)cc1.O=[N+]([O-])c1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene?
The InChIKey is ZUAAQOVSQKCQAJ-IERUDJENSA-N. The full InChI is InChI=1S/C12H9N3O2.C7H8O3S/c16-15(17)12-8-6-11(7-9-12)14-13-10-4-2-1-3-5-10;1-6-2-4-7(5-3-6)11(8,9)10/h1-9H;2-5H,1H3,(H,8,9,10)/b14-13+;.
What are the key properties of 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene?
4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene has a molecular weight of 399.43 g/mol, XLogP of 5.25, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonic acid;(4-nitrophenyl)-phenyldiazene is sourced from PubChem (CID 174911853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).