About benzamide;4-nitrobenzenesulfonic acid
benzamide;4-nitrobenzenesulfonic acid (PubChem CID 131869489) has the molecular formula C13H12N2O6S
and a molecular weight of 324.31 g/mol. Its IUPAC name is benzamide;4-nitrobenzenesulfonic acid.
Molecular Properties
| Compound Name | benzamide;4-nitrobenzenesulfonic acid |
| PubChem CID | 131869489 |
| Molecular Formula | C13H12N2O6S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | benzamide;4-nitrobenzenesulfonic acid |
| SMILES | NC(=O)c1ccccc1.O=[N+]([O-])c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H7NO.C6H5NO5S/c8-7(9)6-4-2-1-3-5-6;8-7(9)5-1-3-6(4-2-5)13(10,11)12/h1-5H,(H2,8,9);1-4H,(H,10,11,12) |
| InChIKey | FBSJCXOQRXXHDW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzamide;4-nitrobenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;4-nitrobenzenesulfonic acid?
The IUPAC name of benzamide;4-nitrobenzenesulfonic acid (CID 131869489) is benzamide;4-nitrobenzenesulfonic acid.
What is the SMILES notation for benzamide;4-nitrobenzenesulfonic acid?
The canonical SMILES for benzamide;4-nitrobenzenesulfonic acid is NC(=O)c1ccccc1.O=[N+]([O-])c1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of benzamide;4-nitrobenzenesulfonic acid?
The InChIKey is FBSJCXOQRXXHDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C6H5NO5S/c8-7(9)6-4-2-1-3-5-6;8-7(9)5-1-3-6(4-2-5)13(10,11)12/h1-5H,(H2,8,9);1-4H,(H,10,11,12).
What are the key properties of benzamide;4-nitrobenzenesulfonic acid?
benzamide;4-nitrobenzenesulfonic acid has a molecular weight of 324.31 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;4-nitrobenzenesulfonic acid is sourced from PubChem (CID 131869489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).