C10H6Na2O7S2 — CID 101310177
disodium;6-oxido-7-sulfonaphthalene-2-sulfonate (PubChem CID 101310177) has the molecular formula C10H6Na2O7S2 and a molecular weight of 348.27 g/mol. Its IUPAC name is disodium;6-oxido-7-sulfonaphthalene-2-sulfonate.
| Compound Name | disodium;6-oxido-7-sulfonaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 101310177 |
| Molecular Formula | C10H6Na2O7S2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | disodium;6-oxido-7-sulfonaphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2cc([O-])c(S(=O)(=O)O)cc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C10H8O7S2.2Na/c11-9-4-6-1-2-8(18(12,13)14)3-7(6)5-10(9)19(15,16)17;;/h1-5,11H,(H,12,13,14)(H,15,16,17);;/q;2*+1/p-2 |
| InChIKey | VNEBWJSWMVTSHK-UHFFFAOYSA-L |
| XLogP | -5.93 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | -5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|